| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Name | (5S,6E,8Z,10E,12R,14Z)-5,12-Dihydroxy-6,8,10,14-Icosatetraenoic Acid |
|---|---|
| Synonyms | "5S,12R-dihydroxy-6Z,8E,10E,14Z-eicosatetraenoic acid"; "5S,12R-d |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 |
| CAS Registry Number | 124629-74-9 |
| SMILES | CCCCC/C=C\C[C@H](/C=C/C=C\C=C\[C@H](CCCC(=O)O)O)O |
| InChI | 1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7-,9-6-,14-10+,15-11+/t18-,19-/m1/s1 |
| InChIKey | VNYSSYRCGWBHLG-GEWAPNICSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.4±50.0°C at 760 mmHg (Cal.) |
| Flash point | 292.3±26.6°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| (1) | Kumiko Ando, Eriko Tsuji, Yuko Ando, Jun-ichi Kunitomo, Reina Kobayashi, Takehiko Yokomizo, Takao Shimizu, Masayuki Yamashita, Shunsaku Ohta, Takeshi Nabe, Shigekatsu Kohno and Yoshitaka Ohishi. Synthesis of 2-, 4- and 5-(2-alkylcarbamoyl-1-methylvinyl)-7-alkyloxybenzo[b]furans and their leukotriene B receptor antagonistic activity, Org. Biomol. Chem., 2005, 3, 2129. |
|---|---|
| Market Analysis Reports |