| Henan Jiayida New Material Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.jydchem.cn | |||
![]() | +86 13608495746 | |||
![]() | wangshuangshuang@jydchem.com | |||
![]() | WhatsApp:+86 13608495746 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Name | Benzoyl leuco methylene blue |
|---|---|
| Synonyms | [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.51 |
| CAS Registry Number | 1249-97-4 |
| EC Number | 215-005-5 |
| SMILES | CN(C)C1=CC2=C(C=C1)N(C3=C(S2)C=C(C=C3)N(C)C)C(=O)C4=CC=CC=C4 |
| Solubility | 0.05183 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.696, Calc.* |
| Melting point | 224.88 °C |
| Boiling Point | 526.29 °C, 589.3±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 310.2±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzoyl leuco methylene blue |