| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Amadis Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8992-5085 | |||
![]() |
sales@amadischem.com | |||
![]() |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| Exfluor Research Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (512) 310-9044 | |||
![]() |
kevin.bierschenk@exfluor.com | |||
| Chemical manufacturer since 1984 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Oakwood Products, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 467-3386 | |||
![]() |
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Methyl Tridecafluoroheptanoate |
| Synonyms | Methyl perfluoroheptanoate; 2,2,3,3,4 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3F13O2 |
| Molecular Weight | 378.09 |
| CAS Registry Number | 14312-89-1 |
| SMILES | FC(F)(C(F)(F)C(=O)OC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C8H3F13O2/c1-23-2(22)3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H3 |
| InChIKey | JHROQORAJUWVCD-UHFFFAOYSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 132.375°C at 760 mmHg (Cal.) |
| 138-139°C (Expl.) | |
| Flash point | 33.785°C (Cal.) |
| Refractive index | 1.291 (Cal.) |
| 1.3022 (Expl.) | |
| Safety Description | IRRITANT |
|---|---|
| Flammable | |
| SDS | Available |
| Market Analysis Reports |