| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Metal halides and halides >> Metal bromide and salt |
|---|---|
| Name | Magnesium Bromate |
| Synonyms | Bromic Acid, Magnesium Salt; Magnesium Bromate |
| Molecular Structure | ![]() |
| Molecular Formula | Br2MgO6 |
| Molecular Weight | 280.11 |
| CAS Registry Number | 14519-17-6 |
| EINECS | 238-530-1 |
| SMILES | [Br]([O-])(=O)=O.[Br]([O-])(=O)=O.[Mg++] |
| InChI | 1S/2BrHO3.Mg/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 |
| InChIKey | RNUHOKZSYYKPPI-UHFFFAOYSA-L |
| Market Analysis Reports |