Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Methyl 4-(Nonyloxy)Benzoate |
|---|---|
| Synonyms | METHYL 4-N-NONYLOXYBENZOATE; Methyl 4-nonyloxybenzoate; methyl-4-n-nonyloxybenzoate |
| Molecular Structure |  |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 |
| CAS Registry Number | 147080-44-2 |
| SMILES | CCCCCCCCCOc1ccc(cc1)C(=O)OC |
| InChI | 1S/C17H26O3/c1-3-4-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19-2/h10-13H,3-9,14H2,1-2H3 |
| InChIKey | OYWJJVYVAIBTQS-UHFFFAOYSA-N |
| Density | 0.982g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.329°C at 760 mmHg (Cal.) |
| Flash point | 158.423°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(Nonyloxy)Benzoate |