| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | n-Undecyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid Undecyl Ester; 2-Methylacrylic Acid Undecyl Ester; 2-Propenoic Acid, 2-Methyl-, Undecyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 |
| CAS Registry Number | 16493-35-9 |
| EINECS | 240-558-4 |
| SMILES | C(OC(C(C)=C)=O)CCCCCCCCCC |
| InChI | 1S/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| InChIKey | KRLHYNPADOCLAJ-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| 0.875 (Expl.) | |
| Boiling point | 305.9±11.0°C at 760 mmHg (Cal.) |
| 148°C (Expl.) | |
| Flash point | 124.4±7.6°C (Cal.) |
| Refractive index | 1.453 (Expl.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | IRRITANT |
| WARNING: Irritates lungs, eyes, skin | |
| SDS | Available |
| (1) | Jian Chen, Peisheng Zhang, Gang Fang, Chao Weng, Jia Hu, Pinggui Yi, Xianyong Yu and Xiaofang Li. One-pot synthesis of amphiphilic reversible photoswitchable fluorescent nanoparticles and their fluorescence modulation properties, Polym. Chem., 2012, 3, 685. |
|---|---|
| Market Analysis Reports |