| Prisun Pharmatech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.prisunpharma.com | |||
![]() | +86 (21) 5432-6183 | |||
![]() | prisun@prisunpharma.com | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | (2S,4S)-1-tert-butyl 2-methyl 4-chloropyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonyms | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-chloropyrrolidine-1,2-dicarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18ClNO4 |
| Molecular Weight | 263.72 |
| CAS Registry Number | 169032-99-9 |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)Cl |
| Solubility | 89.76 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.493, Calc.* |
| Melting point | 29.25 °C |
| Boiling Point | 283.92 °C, 332.4±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 154.9±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H317 Details |
| Safety Statements | P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (2S,4S)-1-tert-butyl 2-methyl 4-chloropyrrolidine-1,2-dicarboxylate |