| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | N-(2-Nitrobenzylidene)Aniline |
|---|---|
| Synonyms | 1-(2-Nitrophenyl)-N-Phenyl-Methanimine; (2-Nitrobenzylidene)-Phenyl-Amine; T0509-0369 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 17064-77-6 |
| EINECS | 241-126-8 |
| SMILES | C1=CC=CC(=C1C=NC2=CC=CC=C2)[N+]([O-])=O |
| InChI | 1S/C13H10N2O2/c16-15(17)13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12/h1-10H |
| InChIKey | BBAZSPGQKPGVIJ-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.361°C at 760 mmHg (Cal.) |
| Flash point | 185.65°C (Cal.) |
| (1) | Margerum J D and Sousa J A. Spectroscopic studies of substituted benzalanilines, Applied Spectroscopy, 1965, 19(3), 91-97 |
|---|---|
| Market Analysis Reports |