| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2 4-Bis(Trimethylsilyl)-6-Azauracil |
|---|---|
| Synonyms | 6-Azauracil, Tms; 1,2,4-Triazine, 3,5-Bis((Trimethylsilyl)Oxy)-; 3,5-Bis(Trimethylsilyloxy)-1,2,4-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H19N3O2Si2 |
| Molecular Weight | 257.44 |
| CAS Registry Number | 17331-61-2 |
| EINECS | 241-353-2 |
| SMILES | C1=NN=C(O[Si](C)(C)C)N=C1O[Si](C)(C)C |
| InChI | 1S/C9H19N3O2Si2/c1-15(2,3)13-8-7-10-12-9(11-8)14-16(4,5)6/h7H,1-6H3 |
| InChIKey | MNMOUFWORYTNCL-UHFFFAOYSA-N |
| Density | 1.011g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.068°C at 760 mmHg (Cal.) |
| Flash point | 116.529°C (Cal.) |
| (1) | Joanna Szczepkowska-Sztolcman, Andrzej Katrusiak, Hanna Wójtowicz-Rajchel and Krzysztof Golankiewicz. Reactions of p-electron rich 1,2,4-triazines with organolithium nucleophiles, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 2549. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2 4-Bis(Trimethylsilyl)-6-Azauracil |