| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Exclusive Chemistry Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (903) 713-5556 | |||
![]() |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| LeadGen Labs, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 645-8468 | |||
![]() |
info@leadgenlabs.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Name | 2,3-Bis(Bromomethyl)Quinoxaline 1,4-Dioxide |
|---|---|
| Synonyms | 2,3-Bis(Bromomethyl)-4-Oxido-Quinoxalin-1-Ium 1-Oxide; 2,3-Bis-Bromomethyl-Quinoxaline 1,4-Dioxide; 2,3-Bis(Bromomethyl)Quinoxaline 1,4-Dioxide |
| Molecular Formula | C10H8Br2N2O2 |
| Molecular Weight | 347.99 |
| CAS Registry Number | 18080-67-6 |
| SMILES | C1=CC=CC2=C1[N+](=C(CBr)C(=[N+]2[O-])CBr)[O-] |
| InChI | 1S/C10H8Br2N2O2/c11-5-9-10(6-12)14(16)8-4-2-1-3-7(8)13(9)15/h1-4H,5-6H2 |
| InChIKey | DQKNFTLRMZOAMG-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| (1) | Evans Kathryn M.. Synthesis and chemical characterisation of target identification reagents based on an inhibitor of human cell invasion by the parasite Toxoplasma gondii, Organic & Biomolecular Chemistry, 2007 |
|---|---|
| Market Analysis Reports |