Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
|
+31 (15) 251-8111 | |||
|
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | Bis(4-Chlorophenyl)Diselenide |
|---|---|
| Synonyms | 1-Chloro-4-(4-Chlorophenyl)Diselanyl-Benzene; Ak-823/41252373; Bis(P-Chlorophenyl) Diselenide |
| Molecular Structure |  |
| Molecular Formula | C12H8Cl2Se2 |
| Molecular Weight | 381.02 |
| CAS Registry Number | 20541-49-5 |
| EINECS | 243-864-6 |
| SMILES | C2=C([Se][Se]C1=CC=C(Cl)C=C1)C=CC(=C2)Cl |
| InChI | 1S/C12H8Cl2Se2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | DVGQWQMPCZYJLR-UHFFFAOYSA-N |
| Boiling point | 424.222°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 210.362°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bis(4-Chlorophenyl)Diselenide |