Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,1,2,2,3,3-Hexafluoroindane |
|---|---|
| Synonyms | 1,1,2,2,3,3-Hexafluoro-indan |
| Molecular Structure |  |
| Molecular Formula | C9H4F6 |
| Molecular Weight | 226.12 |
| CAS Registry Number | 2338-64-9 |
| SMILES | c1ccc2c(c1)C(C(C2(F)F)(F)F)(F)F |
| InChI | 1S/C9H4F6/c10-7(11)5-3-1-2-4-6(5)8(12,13)9(7,14)15/h1-4H |
| InChIKey | LNYHPQJAJVEHPE-UHFFFAOYSA-N |
| Density | 1.482g/cm3 (Cal.) |
|---|---|
| Boiling point | 137.828°C at 760 mmHg (Cal.) |
| Flash point | 34.49°C (Cal.) |
| Refractive index | 1.428 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3-Hexafluoroindane |