| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Classification | API >> Synthetic anti-infective drugs >> Sulfonamides and synergists |
|---|---|
| Name | N-(1,1-Dimethylethyl)-Benzenesulfonamide |
| Synonyms | N-(Tert-Butyl)Benzenesulfonamide; Nsc230371; Enamine_005785 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.29 |
| CAS Registry Number | 2512-24-5 |
| SMILES | C1=C([S](NC(C)(C)C)(=O)=O)C=CC=C1 |
| InChI | 1S/C10H15NO2S/c1-10(2,3)11-14(12,13)9-7-5-4-6-8-9/h4-8,11H,1-3H3 |
| InChIKey | FFUBXANSXRGVKW-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.584°C at 760 mmHg (Cal.) |
| Flash point | 143.451°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Zhaopeng Liu, Norio Shibata and Yoshio Takeuchi. Facile synthesis of disubstituted and spiro five-membered benzosultams mediated by TMSCl–NaI–MeCN reagent, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 302. |
|---|---|
| Market Analysis Reports |