| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | Dibutyl Phenyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Dibutyl Phenyl Ester; Di(N-Butyl) Phenyl Phosphate; Dibutyl Phenylphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23O4P |
| Molecular Weight | 286.31 |
| CAS Registry Number | 2528-36-1 |
| EINECS | 219-772-7 |
| SMILES | C1=C(O[P](OCCCC)(OCCCC)=O)C=CC=C1 |
| InChI | 1S/C14H23O4P/c1-3-5-12-16-19(15,17-13-6-4-2)18-14-10-8-7-9-11-14/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | YICSVBJRVMLQNS-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.263°C at 760 mmHg (Cal.) |
| Flash point | 169.107°C (Cal.) |
| (1) | Kasper Solbu, Hanne Line Daae, Syvert Thorud, Dag Gunnar Ellingsen, Elsa Lundanes and Paal Molander. Exposure to airborne organophosphates originating from hydraulic and turbine oils among aviation technicians and loaders, J. Environ. Monit., 2010, 12, 2259. |
|---|---|
| Market Analysis Reports |