|
CAS#: 26062-78-2 Product: Phenol, Polymer With Ethenylbenzene No suppilers available for the product. |
| Name | Phenol, Polymer With Ethenylbenzene |
|---|---|
| Synonyms | Ethenylbenzene; Phenol; Phenol, Nonyl Derivs, Phosphosulfurized, Reaction Products With Styrene |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 |
| CAS Registry Number | 26062-78-2 |
| EINECS | 268-360-3 |
| SMILES | C1=C(O)C=CC=C1.C2=C(C=CC=C2)C=C |
| InChI | 1S/C8H8.C6H6O/c1-2-8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h2-7H,1H2;1-5,7H |
| InChIKey | UZRCGISJYYLJMA-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |