Online Database of Chemicals from Around the World
| Name | 1-Diethoxyphosphoryl-2-(Trichloromethyl)Benzene |
|---|---|
| Synonyms | Phosphonic Acid (Alpha,Alpha,Alpha-Trichlorotolyl)-, Diethyl Ester; (Alpha,Alpha,Alpha-Trichlorotolyl)Phosphonic Acid Diethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C11H14Cl3O3P |
| Molecular Weight | 331.56 |
| CAS Registry Number | 28652-49-5 |
| SMILES | C1=C(C(=CC=C1)[P](=O)(OCC)OCC)C(Cl)(Cl)Cl |
| InChI | 1S/C11H14Cl3O3P/c1-3-16-18(15,17-4-2)10-8-6-5-7-9(10)11(12,13)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | NBZLAHSLQHMJAR-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.779°C at 760 mmHg (Cal.) |
| Flash point | 282.452°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Diethoxyphosphoryl-2-(Trichloromethyl)Benzene |
