Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2-Dimethylbutanoic Anhydride |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 |
| CAS Registry Number | 29138-64-5 |
| SMILES | CCC(C)(C)C(=O)OC(=O)C(C)(C)CC |
| InChI | 1S/C12H22O3/c1-7-11(3,4)9(13)15-10(14)12(5,6)8-2/h7-8H2,1-6H3 |
| InChIKey | IENNOUHEKVPMRP-UHFFFAOYSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.204°C at 760 mmHg (Cal.) |
| Flash point | 95.72°C (Cal.) |
| Refractive index | 1.436 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethylbutanoic Anhydride |