| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Aromatic cinnamic acid, esters and derivatives |
|---|---|
| Name | (2E)-4-(4-Ethoxyphenyl)-4-Oxo-2-Butenoic Acid |
| Synonyms | (E)-4-(4-Ethoxyphenyl)-4-Oxo-But-2-Enoate; (E)-4-(4-Ethoxyphenyl)-4-Keto-But-2-Enoate; Zinc00129057 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11O4 |
| Molecular Weight | 219.22 |
| CAS Registry Number | 29582-31-8 |
| SMILES | C1=C(OCC)C=CC(=C1)C(=O)\C=C\C([O-])=O |
| InChI | 1S/C12H12O4/c1-2-16-10-5-3-9(4-6-10)11(13)7-8-12(14)15/h3-8H,2H2,1H3,(H,14,15)/p-1/b8-7+ |
| InChIKey | WKIKNOMECIZQHQ-BQYQJAHWSA-M |
| Boiling point | 398.221°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.187°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |