Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Isopropyldiphenylphosphine Oxide |
|---|---|
| Synonyms | (Isopropyl-Phenyl-Phosphoryl)Benzene; (Isopropyl-Phenylphosphoryl)Benzene; (Phenyl-Propan-2-Yl-Phosphoryl)Benzene |
| Molecular Structure |  |
| Molecular Formula | C15H17OP |
| Molecular Weight | 244.27 |
| CAS Registry Number | 2959-75-3 |
| EINECS | 220-989-4 |
| SMILES | C2=C([P](=O)(C(C)C)C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C15H17OP/c1-13(2)17(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13H,1-2H3 |
| InChIKey | CLPTUIWEBUOUCQ-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.883°C at 760 mmHg (Cal.) |
| Flash point | 155.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyldiphenylphosphine Oxide |