Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(4-Chlorophenyl)-1-Ethylthiourea |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.71 |
| CAS Registry Number | 30650-20-5 |
| SMILES | CCN(C1=CC=C(C=C1)Cl)C(=S)N |
| InChI | 1S/C9H11ClN2S/c1-2-12(9(11)13)8-5-3-7(10)4-6-8/h3-6H,2H2,1H3,(H2,11,13) |
| InChIKey | UAAIWIMNCSXWHR-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.5±44.0°C at 760 mmHg (Cal.) |
| Flash point | 153.7±28.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-1-Ethylthiourea |