| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Classification | API >> Antibiotics >> Aminoglycoside |
|---|---|
| Name | Viomycin |
| Synonyms | (3S)-3,6-Diamino-N-[(3S,6Z,9S,12S,15S)-3-[(4R,6S)-2-Amino-6-Hydroxy-3,4,5,6-Tetrahydropyrimidin-4-Yl]-9,12-Bis(Hydroxymethyl)-2,5,8,11,14-Pentaoxo-6-(Ureidomethylene)-1,4,7,10,13-Pentazacyclohexadec-15-Yl]Hexanamide; (3S)-3,6-Diamino-N-[(3S,6Z,9S,12S,15S)-3-[(4R,6S)-2-Amino-6-Hydroxy-3,4,5,6-Tetrahydropyrimidin-4-Yl]-2,5,8,11,14-Pentaketo-9,12-Dimethylol-6-(Ureidomethylene)-1,4,7,10,13-Pentazacyclohexadec-15-Yl]Hexanamide; (3S)-3,6-Diamino-N-[(3S,6Z,9S,12S,15S)-6-[(Aminocarbonylamino)Methylidene]-3-[(4R,6S)-2-Amino-6-Hydroxy-3,4,5,6-Tetrahydropyrimidin-4-Yl]-9,12-Bis(Hydroxymethyl)-2,5,8,11,14-Pentaoxo-1,4,7,10,13-Pentazacyclohexadec-15-Yl]Hexanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C25H43N13O10 |
| Molecular Weight | 685.70 |
| CAS Registry Number | 32988-50-4 |
| EINECS | 251-323-0 |
| SMILES | [C@H]1(NC(\C(NC([C@@H](NC([C@@H](NC([C@H](CNC1=O)NC(C[C@H](CCCN)N)=O)=O)CO)=O)CO)=O)=C\NC(=O)N)=O)[C@@H]2NC(=N[C@H](C2)O)N |
| InChI | 1S/C25H43N13O10/c26-3-1-2-10(27)4-16(41)32-12-6-30-23(47)18(11-5-17(42)37-24(28)36-11)38-20(44)13(7-31-25(29)48)33-21(45)14(8-39)35-22(46)15(9-40)34-19(12)43/h7,10-12,14-15,17-18,39-40,42H,1-6,8-9,26-27H2,(H,30,47)(H,32,41)(H,33,45)(H,34,43)(H,35,46)(H,38,44)(H3,28,36,37)(H3,29,31,48)/b13-7-/t10-,11+,12-,14-,15-,17-,18-/m0/s1 |
| InChIKey | GXFAIFRPOKBQRV-GHXCTMGLSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| (1) | Wai-Ho Lam, Kathrin Rychli and Timothy D. H. Bugg. Identification of a novel β-replacement reaction in the biosynthesis of 2,3-diaminobutyric acid in peptidylnucleoside mureidomycin A, Org. Biomol. Chem., 2008, 6, 1912. |
|---|---|
| Market Analysis Reports |