| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1-Azido-Pyrene |
|---|---|
| Synonyms | Azidopyrene; Pyrene, 1-Azido- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9N3 |
| Molecular Weight | 243.27 |
| CAS Registry Number | 36171-39-8 |
| SMILES | [N+](=NC4=C1C=CC2=CC=CC3=CC=C(C1=C23)C=C4)=[N-] |
| InChI | 1S/C16H9N3/c17-19-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | BMNGOGRNWBJJKB-UHFFFAOYSA-N |
| (1) | Wolfgang Schmucker, Stefanie Klumpp, Frank Hennrich, Manfred Kappes and Hans-Achim Wagenknecht. A simple pyrene “click”-type modification of DNA affects solubilisation and photoluminescence of single-walled carbon nanotubes, RSC Advances, 2013, 3, 6331. |
|---|---|
| Market Analysis Reports |