Online Database of Chemicals from Around the World
|
CAS#: 4589-33-7 Product: Bostrycoidin No suppilers available for the product. |
| Name | Bostrycoidin |
|---|---|
| Synonyms | Benz(G)Isoquinoline-5,10-Dione, 6,9-Dihydroxy-7-Methoxy-3-Methyl-; Bostrycoidin; Nsc 103645 |
| Molecular Structure |  |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 |
| CAS Registry Number | 4589-33-7 |
| SMILES | CC2=CC1=C(O)C3=C(C(=O)C1=CN2)C(=O)C=C(OC)C3=O |
| InChI | 1S/C15H11NO5/c1-6-3-7-8(5-16-6)14(19)11-9(17)4-10(21-2)15(20)12(11)13(7)18/h3-5,16,18H,1-2H3 |
| InChIKey | GRDUAFOUVFRDBR-UHFFFAOYSA-N |
| Density | 1.521g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.456°C at 760 mmHg (Cal.) |
| Flash point | 235.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bostrycoidin |