| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Nervous system medication >> Sedative and hypnotics |
|---|---|
| Name | Ethypicone |
| Synonyms | 3,3-Diethyl-5-Methyl-1H-Pyridine-2,4-Quinone; 3,3-Diethyl-5-Methyl-2,4(1H,3H)-Pyridinedione; 5-Methylpyrithyldione |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 |
| CAS Registry Number | 467-90-3 |
| SMILES | C(C1(C(C(=CNC1=O)C)=O)CC)C |
| InChI | 1S/C10H15NO2/c1-4-10(5-2)8(12)7(3)6-11-9(10)13/h6H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | WELBEQNHUMMKEL-UHFFFAOYSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.243°C at 760 mmHg (Cal.) |
| Flash point | 143.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethypicone |