Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-[5-(Acetyloxy)-1-Naphthalenyl]-Acetamide |
|---|---|
| Synonyms | (5-Acetamido-1-Naphthyl) Acetate; Acetic Acid (5-Acetamido-1-Naphthyl) Ester; (5-Acetamidonaphthalen-1-Yl) Ethanoate |
| Molecular Structure | ![CAS#: 46874-41-3， N-[5-(Acetyloxy)-1-Naphthalenyl]-Acetamide](/moreStructures/46874-41-3.gif) |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 46874-41-3 |
| EINECS | 256-285-9 |
| SMILES | C1=CC2=C(C(=C1)OC(=O)C)C=CC=C2NC(=O)C |
| InChI | 1S/C14H13NO3/c1-9(16)15-13-7-3-6-12-11(13)5-4-8-14(12)18-10(2)17/h3-8H,1-2H3,(H,15,16) |
| InChIKey | RSZZTTIBNGXAEI-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.23°C at 760 mmHg (Cal.) |
| Flash point | 243.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[5-(Acetyloxy)-1-Naphthalenyl]-Acetamide |