Online Database of Chemicals from Around the World
|
CAS#: 478-29-5 Product: 1,5,6-Trihydroxy-2-Methyl-Anthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,5,6-Trihydroxy-2-Methyl-Anthracene-9,10-Dione |
|---|---|
| Synonyms | 1,2,5-Trihydroxy-6-Methyl-Anthracene-9,10-Dione; 1,2,5-Trihydroxy-6-Methyl-9,10-Anthraquinone; Morindon |
| Molecular Structure |  |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 478-29-5 |
| SMILES | C1=CC(=C(C2=C1C(C3=C(C2=O)C=CC(=C3O)O)=O)O)C |
| InChI | 1S/C15H10O5/c1-6-2-3-7-10(12(6)17)13(18)8-4-5-9(16)15(20)11(8)14(7)19/h2-5,16-17,20H,1H3 |
| InChIKey | BATFHSIVMJJJAF-UHFFFAOYSA-N |
| Density | 1.584g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.8°C at 760 mmHg (Cal.) |
| Flash point | 267.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5,6-Trihydroxy-2-Methyl-Anthracene-9,10-Dione |