Online Database of Chemicals from Around the World
|
CAS#: 481-87-8 Product: Ibogamine No suppilers available for the product. |
| Name | Ibogamine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 |
| CAS Registry Number | 481-87-8 |
| SMILES | [C@@H]15N2C[C@H](C[C@H]1C4=C(CC2)C3=CC=CC=C3[NH]4)C[C@@H]5CC |
| InChI | 1S/C19H24N2/c1-2-13-9-12-10-16-18-15(7-8-21(11-12)19(13)16)14-5-3-4-6-17(14)20-18/h3-6,12-13,16,19-20H,2,7-11H2,1H3/t12-,13-,16-,19-/m0/s1 |
| InChIKey | LRLCVRYKAFDXKU-DYIBVVGTSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.236°C at 760 mmHg (Cal.) |
| Flash point | 227.305°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ibogamine |