Online Database of Chemicals from Around the World
| Name | 1-Methylene-4-(1-Methylvinyl)Cyclohexane |
|---|---|
| Synonyms | 1-Isopropenyl-4-Methylene-Cyclohexane; 1-Isopropenyl-4-Methylenecyclohexane; 1-Methylidene-4-Prop-1-En-2-Yl-Cyclohexane |
| Molecular Structure |  |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 |
| CAS Registry Number | 499-97-8 |
| EINECS | 207-895-9 |
| SMILES | CC(=C)[CH]1CC[C](CC1)=[CH2] |
| InChI | 1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h10H,1,3-7H2,2H3 |
| InChIKey | GOQRXDTWKVYHJH-UHFFFAOYSA-N |
| Density | 0.821g/cm3 (Cal.) |
|---|---|
| Boiling point | 171.75°C at 760 mmHg (Cal.) |
| Flash point | 43.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methylene-4-(1-Methylvinyl)Cyclohexane |
