Online Database of Chemicals from Around the World
|
CAS#: 51724-48-2 Product: Trichothecene No suppilers available for the product. |
| Name | Trichothecene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 51724-48-2 |
| SMILES | [C@]12([C@@]3(C([C@H](O[C@@H]1C=C(CC2)C)CC3)C)C)C |
| InChI | 1S/C15H24O/c1-10-5-7-15(4)13(9-10)16-12-6-8-14(15,3)11(12)2/h9,11-13H,5-8H2,1-4H3/t11?,12-,13-,14+,15+/m1/s1 |
| InChIKey | FXELQRCNOUMUMW-IWNKAIHXSA-N |
| Density | 0.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.476°C at 760 mmHg (Cal.) |
| Flash point | 118.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichothecene |