| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | Ammonium 2-(Sulphonatooxy)Ethyl Methacrylate |
|---|---|
| Synonyms | Ammonia; 2-Sulfooxyethyl 2-Methylprop-2-Enoate; Ammonia; 2-Methylprop-2-Enoic Acid 2-Sulfooxyethyl Ester; Ammonia; 2-Methylacrylic Acid 2-Sulfoxyethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO6S |
| Molecular Weight | 227.23 |
| CAS Registry Number | 53621-34-4 |
| EINECS | 258-668-6 |
| SMILES | C(OC(=O)C(C)=C)CO[S](O)(=O)=O.N |
| InChI | 1S/C6H10O6S.H3N/c1-5(2)6(7)11-3-4-12-13(8,9)10;/h1,3-4H2,2H3,(H,8,9,10);1H3 |
| InChIKey | WCDLJSPFRWZKPF-UHFFFAOYSA-N |
| Boiling point | 411°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 202.4°C (Cal.) |
| (1) | Kay L. Robinson, Jonathan V. M. Weaver, Steven P. Armes, Eva Diaz Marti and Fiona C. Meldrum. Synthesis of controlled-structure sulfate-based copolymers via atom transfer radical polymerisation and their use as crystal habit modifiers for BaSO, J. Mater. Chem., 2002, 12, 890. |
|---|---|
| Market Analysis Reports |