| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Simagchem Corporation | China | |||
|---|---|---|---|---|
![]() |
+86 13806087780 | |||
![]() |
sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink premium supplier since 2020 | ||||
| Name | Betamethasone-17-Butyrate-21-Propionate |
|---|---|
| Synonyms | Butanoic Acid [(8S,9R,10S,11S,13S,14S,16S,17R)-9-Fluoro-11-Hydroxy-10,13,16-Trimethyl-3-Oxo-17-[1-Oxo-2-(1-Oxopropoxy)Ethyl]-6,7,8,11,12,14,15,16-Octahydrocyclopenta[A]Phenanthren-17-Yl] Ester; Butyric Acid [(8S,9R,10S,11S,13S,14S,16S,17R)-9-Fluoro-11-Hydroxy-3-Keto-10,13,16-Trimethyl-17-(2-Propionyloxyacetyl)-6,7,8,11,12,14,15,16-Octahydrocyclopenta[A]Phenanthren-17-Yl] Ester; [(8S,9R,10S,11S,13S,14S,16S,17R)-9-Fluoro-11-Hydroxy-10,13,16-Trimethyl-3-Oxo-17-(2-Propanoyloxyethanoyl)-6,7,8,11,12,14,15,16-Octahydrocyclopenta[A]Phenanthren-17-Yl] Butanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C29H39FO7 |
| Molecular Weight | 518.62 |
| CAS Registry Number | 5534-02-1 |
| SMILES | [C@@]4([C@@]3([C@H]([C@H]2[C@]([C@@]1(C(=CC(=O)C=C1)CC2)C)(F)[C@H](C3)O)C[C@@H]4C)C)(C(COC(CC)=O)=O)OC(CCC)=O |
| InChI | 1S/C29H39FO7/c1-6-8-25(35)37-29(23(33)16-36-24(34)7-2)17(3)13-21-20-10-9-18-14-19(31)11-12-26(18,4)28(20,30)22(32)15-27(21,29)5/h11-12,14,17,20-22,32H,6-10,13,15-16H2,1-5H3/t17-,20-,21-,22-,26-,27-,28-,29-/m0/s1 |
| InChIKey | VXOWJCTXWVWLLC-REGDIAEZSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.017°C at 760 mmHg (Cal.) |
| Flash point | 324.541°C (Cal.) |
| (1) | Xin-Yi Cao, Yuan-Gen Yao, Stuart R. Batten, En Ma, Ye-Yan Qin, Jian Zhang, Rui-Bo Zhang and Jian-Kai Cheng. Unusual parallel entanglement of metal–organic 2D frameworks with coexistence of polyrotaxane, polycatenane and interdigitation, CrystEngComm, 2009, 11, 1030. |
|---|---|
| Market Analysis Reports |