Online Database of Chemicals from Around the World
| Name | 1-N-Methyl-2-Nitrobenzimidazole |
|---|---|
| Synonyms | 1-Methyl-2-Nitro-Benzimidazole; Benzimidazole, 1-Methyl-2-Nitro-; 1-N-Methyl-2-Nitrobenzimidazole |
| Molecular Structure |  |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 5709-68-2 |
| SMILES | C1=CC=CC2=C1[N](C(=N2)[N+]([O-])=O)C |
| InChI | 1S/C8H7N3O2/c1-10-7-5-3-2-4-6(7)9-8(10)11(12)13/h2-5H,1H3 |
| InChIKey | YGVJTZIZVPQREL-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.603°C at 760 mmHg (Cal.) |
| Flash point | 182.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-N-Methyl-2-Nitrobenzimidazole |
