Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
|
+7 (906) 781-2021 | |||
|
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Glucuronic Acid |
|---|---|
| Synonyms | 3,4,5,6-Tetrahydroxytetrahydropyran-2-Carboxylic Acid; 3,4,5,6-Tetrahydroxy-2-Tetrahydropyrancarboxylic Acid; Ncgc00142366-01 |
| Molecular Structure |  |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 |
| CAS Registry Number | 576-37-4 |
| EINECS | 209-401-7 |
| SMILES | O=C(C1C(C(C(O)C(O1)O)O)O)O |
| InChI | 1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11) |
| InChIKey | AEMOLEFTQBMNLQ-UHFFFAOYSA-N |
| Density | 1.987g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.235°C at 760 mmHg (Cal.) |
| Flash point | 211.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glucuronic Acid |