Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | Tris(4-Nitrophenyl)Methanol |
|---|---|
| Synonyms | Methanol, Tris(P-Nitrophenyl)-; Nsc87329; Tris(4-Nitrotriphenyl)Methanol |
| Molecular Structure |  |
| Molecular Formula | C19H13N3O7 |
| Molecular Weight | 395.33 |
| CAS Registry Number | 596-48-5 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)C(C2=CC=C(C=C2)[N+]([O-])=O)(O)C3=CC=C(C=C3)[N+]([O-])=O |
| InChI | 1S/C19H13N3O7/c23-19(13-1-7-16(8-2-13)20(24)25,14-3-9-17(10-4-14)21(26)27)15-5-11-18(12-6-15)22(28)29/h1-12,23H |
| InChIKey | VITHLMCGSJCNMI-UHFFFAOYSA-N |
| Density | 1.487g/cm3 (Cal.) |
|---|---|
| Boiling point | 638.111°C at 760 mmHg (Cal.) |
| Flash point | 255.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(4-Nitrophenyl)Methanol |