Online Database of Chemicals from Around the World
|
CAS#: 6251-70-3 Product: 21-Deoxytetrahydroaldosterone No suppilers available for the product. |
| Name | 21-Deoxytetrahydroaldosterone |
|---|---|
| Synonyms | 3,18-Dihydroxy-11,18-Epoxy-Pregnan-20-One; Pregnan-20-One, 11,18-Epoxy-3,18-Dihydroxy-, (3Alpha,5Beta,11Beta)- |
| Molecular Structure |  |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 |
| CAS Registry Number | 6251-70-3 |
| SMILES | [C@H]1(CC[C@]4([C@@H](C1)CC[C@H]5[C@@H]2CC[C@H](C(C)=O)C23C(O)O[C@H](C3)[C@H]45)C)O |
| InChI | 1S/C21H32O4/c1-11(22)15-5-6-16-14-4-3-12-9-13(23)7-8-20(12,2)18(14)17-10-21(15,16)19(24)25-17/h12-19,23-24H,3-10H2,1-2H3/t12-,13-,14+,15-,16+,17-,18-,19?,20+,21?/m1/s1 |
| InChIKey | PLHRGCFLRHONCI-UELVEZJDSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.014°C at 760 mmHg (Cal.) |
| Flash point | 179.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 21-Deoxytetrahydroaldosterone |