Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Fluoro-2(1H)-quinolinone |
|---|---|
| Synonyms | 2(1H)-Quinolinone,5-fluoro-; 5-fluoroquinolin-2(1H)-one |
| Molecular Structure |  |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 |
| CAS Registry Number | 643752-95-8 |
| SMILES | c1cc2c(ccc(=O)[nH]2)c(c1)F |
| InChI | 1S/C9H6FNO/c10-7-2-1-3-8-6(7)4-5-9(12)11-8/h1-5H,(H,11,12) |
| InChIKey | WUWLDOZFKQIIQW-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.459°C at 760 mmHg (Cal.) |
| Flash point | 154.261°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Fluoro-2(1H)-quinolinone |