Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 7-Amino-5,8-quinolinedione |
|---|---|
| Synonyms | 7-Amino-quinoline-5,8-dione; 7-AMINOQUINOLINE-5,8-DIONE; NSC76885 |
| Molecular Structure |  |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 |
| CAS Registry Number | 65185-82-2 |
| SMILES | C1=CC2=C(C(=O)C(=CC2=O)N)N=C1 |
| InChI | 1S/C9H6N2O2/c10-6-4-7(12)5-2-1-3-11-8(5)9(6)13/h1-4H,10H2 |
| InChIKey | QHJBNEFEIDZZCN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 173.9±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Amino-5,8-quinolinedione |