Online Database of Chemicals from Around the World
|
CAS#: 65882-70-4 Product: 4-Nitrosobibenzyl No suppilers available for the product. |
| Name | 4-Nitrosobibenzyl |
|---|---|
| Synonyms | 4-Nitrosobibenzyl; Benzene, 1-Nitroso-4-(2-Phenylethyl)-; Para-Nitrosobibenzyl |
| Molecular Structure |  |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 65882-70-4 |
| SMILES | C2=C(CCC1=CC=CC=C1)C=CC(=C2)N=O |
| InChI | 1S/C14H13NO/c16-15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-5,8-11H,6-7H2 |
| InChIKey | YNDICJLZZXHSIX-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.09°C at 760 mmHg (Cal.) |
| Flash point | 130.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrosobibenzyl |