Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Ethylfenchol |
|---|---|
| Synonyms | 2-Ethyl-1,3,3-Trimethyl-Norbornan-2-Ol; 2-Ethyl-1,3,3-Trimethyl-2-Norbornanol; 6-Ethyl-1,5,5-Trimethyl-Bicyclo[2.2.1]Heptan-6-Ol |
| Molecular Structure |  |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 67952-68-5 |
| EINECS | 267-922-5 |
| SMILES | C(C1(C(C2CCC1(C2)C)(C)C)O)C |
| InChI | 1S/C12H22O/c1-5-12(13)10(2,3)9-6-7-11(12,4)8-9/h9,13H,5-8H2,1-4H3 |
| InChIKey | KIPCKEJKGCXRGA-UHFFFAOYSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.292°C at 760 mmHg (Cal.) |
| Flash point | 88.889°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylfenchol |