| Tianjin Zhongxin Chem-tech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.tjzxchem.com | |||
![]() | +86 (22) 6688-0623 | |||
![]() | +86 (22) 8988-0739 ex 8030 | |||
![]() | sales@tjzxchem.com | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Premium supplier since 2009 | ||||
| Classification | Organic raw materials >> Organic fluorine compound |
|---|---|
| Name | Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H19S2.PF6 |
| Molecular Weight | 516.50 |
| CAS Registry Number | 68156-13-8 |
| EC Number | 269-006-0 |
| SMILES | F[P-](F)(F)(F)(F)F.C1=CC=CC(SC2C=CC=CC=2)=C1[S+](C1C=CC=CC=1)C1C=CC=CC=1 |
| Hazard Classification | |||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||||||||||||||||||||||||||||||
|
Diphenyl(4-phenylthio)phenylsulfonium hexafluorophosphate is a notable compound in the field of organosulfur chemistry, with significant applications in the industry, particularly in photoinitiation and polymerization processes. This chemical substance, characterized by its sulfonium group and hexafluorophosphate counterion, is used extensively in various technological and industrial applications due to its unique chemical properties. The discovery of diphenyl(4-phenylthio)phenylsulfonium hexafluorophosphate can be traced back to the study of sulfonium salts and their role in photoinitiation systems. Researchers exploring the synthesis and application of sulfonium salts identified this compound as a potential candidate for use in photoinitiation due to its efficient ability to generate radicals upon exposure to light. The hexafluorophosphate counterion was found to enhance the stability and solubility of the sulfonium salt in various solvents, making it a valuable compound for industrial use. One of the primary applications of diphenyl(4-phenylthio)phenylsulfonium hexafluorophosphate is in the field of photoinitiation. Photoinitiators are crucial in processes where light is used to initiate polymerization reactions. In the presence of ultraviolet (UV) light, diphenyl(4-phenylthio)phenylsulfonium hexafluorophosphate decomposes to produce radicals that initiate the polymerization of acrylates and methacrylates. This property makes it highly valuable in the production of various photopolymerizable materials, including coatings, adhesives, and inks. Its effectiveness as a photoinitiator is attributed to its ability to generate reactive species efficiently, leading to rapid polymerization and hardening of the material upon exposure to light. The compound also finds applications in the development of advanced materials. Its use as a photoinitiator is particularly advantageous in the production of high-performance resins and composites. The ability to initiate polymerization with precision allows for the creation of materials with controlled properties, such as improved mechanical strength and thermal stability. These materials are utilized in various industries, including electronics, automotive, and aerospace, where high-performance materials are essential. Another significant application of diphenyl(4-phenylthio)phenylsulfonium hexafluorophosphate is in the field of lithography. In this context, it is used as a component in photoresists, which are light-sensitive materials applied to substrates during the photolithography process. The compound's ability to generate radicals upon exposure to light makes it suitable for use in photoresist formulations, where it facilitates the development of precise patterns on semiconductor wafers and other substrates. This application is crucial in the production of microelectronic devices and integrated circuits. Furthermore, the compound's stability and solubility properties make it a suitable candidate for use in various other chemical processes where controlled polymerization or cross-linking is required. Its ability to function as a reliable photoinitiator under different conditions enhances its versatility and applicability in diverse industrial and research settings. In summary, diphenyl(4-phenylthio)phenylsulfonium hexafluorophosphate is a valuable compound with significant applications in photoinitiation, advanced materials development, and lithography. Its discovery has paved the way for advancements in polymer chemistry and material science, providing essential tools for the production of high-performance materials and devices. References none |
| Market Analysis Reports |