Online Database of Chemicals from Around the World
|
CAS#: 6833-64-3 Product: 4-(Phenylazo)Benzene-1,2-Diol No suppilers available for the product. |
| Name | 4-(Phenylazo)Benzene-1,2-Diol |
|---|---|
| Synonyms | 4-(N'-Phenylhydrazino)-1,2-Benzoquinone; 4-(N'-Phenylhydrazino)-O-Benzoquinone; Nsc522192 |
| Molecular Structure |  |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 6833-64-3 |
| SMILES | C2=C(NNC1=CC(=O)C(=O)C=C1)C=CC=C2 |
| InChI | 1S/C12H10N2O2/c15-11-7-6-10(8-12(11)16)14-13-9-4-2-1-3-5-9/h1-8,13-14H |
| InChIKey | SLZCLEVUXDHQQE-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.139°C at 760 mmHg (Cal.) |
| Flash point | 100.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Phenylazo)Benzene-1,2-Diol |