|
CAS#: 69002-94-4 Product: 4-(1H-Benzoimidazol-2-Ylsulfanyl)-Butyric Acid No suppilers available for the product. |
| Name | 4-(1H-Benzoimidazol-2-Ylsulfanyl)-Butyric Acid |
|---|---|
| Synonyms | 4-(1H-Benzimidazol-2-Ylthio)Butanoate; 4-(1H-Benzimidazol-2-Ylthio)Butyrate; Zinc03268042 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N2O2S |
| Molecular Weight | 235.28 |
| CAS Registry Number | 69002-94-4 |
| SMILES | C2=C1[NH]C(=NC1=CC=C2)SCCCC([O-])=O |
| InChI | 1S/C11H12N2O2S/c14-10(15)6-3-7-16-11-12-8-4-1-2-5-9(8)13-11/h1-2,4-5H,3,6-7H2,(H,12,13)(H,14,15)/p-1 |
| InChIKey | HDIDVWDIDBGIAM-UHFFFAOYSA-M |
| Boiling point | 505.567°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 259.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1H-Benzoimidazol-2-Ylsulfanyl)-Butyric Acid |