|
CAS#: 69618-85-5 Product: (1,1'-Biphenyl)-3-Yl-beta-D-Glucopyranosiduronic Acid No suppilers available for the product. |
| Name | (1,1'-Biphenyl)-3-Yl-beta-D-Glucopyranosiduronic Acid |
|---|---|
| Synonyms | (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(3-Phenylphenoxy)Tetrahydropyran-2-Carboxylic Acid; (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(3-Phenylphenoxy)-2-Tetrahydropyrancarboxylic Acid; Beta-D-Glucopyranosiduronic Acid, (1,1'-Biphenyl)-3-Yl |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 |
| CAS Registry Number | 69618-85-5 |
| SMILES | [C@H]3(OC1=CC(=CC=C1)C2=CC=CC=C2)[C@H](O)[C@@H](O)[C@H](O)[C@H](O3)C(=O)O |
| InChI | 1S/C18H18O7/c19-13-14(20)16(17(22)23)25-18(15(13)21)24-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,13-16,18-21H,(H,22,23)/t13-,14-,15+,16-,18+/m0/s1 |
| InChIKey | QWAOLAZGPWUPMJ-RNGZQALNSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 623.304°C at 760 mmHg (Cal.) |
| Flash point | 229.248°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,1'-Biphenyl)-3-Yl-beta-D-Glucopyranosiduronic Acid |