Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1H-Purine-6-carbonyl chloride |
|---|---|
| Synonyms | 1H-Purine-6-carbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C6H3ClN4O |
| Molecular Weight | 182.57 |
| CAS Registry Number | 70265-75-7 |
| SMILES | c1[nH]c2c(ncnc2n1)C(=O)Cl |
| InChI | 1S/C6H3ClN4O/c7-5(12)3-4-6(10-1-8-3)11-2-9-4/h1-2H,(H,8,9,10,11) |
| InChIKey | CAUCPJLWZZKTSP-UHFFFAOYSA-N |
| Density | 1.691g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.912°C at 760 mmHg (Cal.) |
| Flash point | 246.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Purine-6-carbonyl chloride |