Online Database of Chemicals from Around the World
|
CAS#: 7205-96-1 Product: Chloromethyl(p-Methoxyphenyl) Sulfone No suppilers available for the product. |
| Name | Chloromethyl(p-Methoxyphenyl) Sulfone |
|---|---|
| Synonyms | 1-(Chloromethylsulfonyl)-4-Methoxy-Benzene; Anisole, P-[(Chloromethyl)Sulfonyl]-; Benzene, 1-[(Chloromethyl)Sulfonyl]-4-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C8H9ClO3S |
| Molecular Weight | 220.67 |
| CAS Registry Number | 7205-96-1 |
| SMILES | C1=CC(=CC=C1OC)[S](=O)(=O)CCl |
| InChI | 1S/C8H9ClO3S/c1-12-7-2-4-8(5-3-7)13(10,11)6-9/h2-5H,6H2,1H3 |
| InChIKey | YEAQVAIQWMHJFO-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.091°C at 760 mmHg (Cal.) |
| Flash point | 180.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloromethyl(p-Methoxyphenyl) Sulfone |