| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | 4-(Isothiocyanatomethyl)phenyl 6-deoxy-α-L-mannopyranoside |
|---|---|
| Synonyms | (2S,3R,4R,5R,6S)-2-[4-(isothiocyanatomethyl)phenoxy]-6-methyloxane-3,4,5-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.35 |
| CAS Registry Number | 73255-40-0 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)CN=C=S)O)O)O |
| Solubility | 1734 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.628, Calc.* |
| Melting point | 195.71 °C |
| Boiling Point | 472.29 °C, 523.7±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 270.5±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4-(Isothiocyanatomethyl)phenyl 6-deoxy-α-L-mannopyranoside |