Online Database of Chemicals from Around the World
|
CAS#: 80-42-2 Product: Propyl Benzenesulphonate No suppilers available for the product. |
| Name | Propyl Benzenesulphonate |
|---|---|
| Synonyms | Benzenesulfonic Acid Propyl Ester; Benzenesulfonic Acid, Propyl Ester; Nsc3216 |
| Molecular Structure |  |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.25 |
| CAS Registry Number | 80-42-2 |
| EINECS | 201-278-8 |
| SMILES | C1=CC=CC=C1[S](OCCC)(=O)=O |
| InChI | 1S/C9H12O3S/c1-2-8-12-13(10,11)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | OCNPXKLQSGAGKT-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.824°C at 760 mmHg (Cal.) |
| Flash point | 134.524°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Propyl Benzenesulphonate |