Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4,4,7-Tetramethylnona-6,8-Dien-3-One Oxime |
|---|---|
| Synonyms | (6E)-2,4,4,7-Tetramethylnona-6,8-Dien-3-One Oxime; 2,4,4,7-Tetramethylnona-6,8-Dien-3-One Oxime |
| Molecular Structure |  |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 |
| CAS Registry Number | 81783-01-9 |
| EINECS | 279-817-1 |
| SMILES | C(C(C(=N/O)/C(C)C)(C)C)\C=C(C=C)/C |
| InChI | 1S/C13H23NO/c1-7-11(4)8-9-13(5,6)12(14-15)10(2)3/h7-8,10,15H,1,9H2,2-6H3/b11-8+,14-12+ |
| InChIKey | MEJYWDUBOCZFFS-RKZGRAQHSA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.618°C at 760 mmHg (Cal.) |
| Flash point | 185.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,4,7-Tetramethylnona-6,8-Dien-3-One Oxime |