Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 11,11-Dimethyltricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dione |
|---|---|
| Synonyms | 9,9-dimethyl-1,4-methanonaphthalene-2,3(1H,4H)-dione |
| Molecular Structure | ![CAS#: 84574-74-3， 11,11-Dimethyltricyclo[6.2.1.0<sup>2,7</sup>]undeca-2,4,6-triene-9,10-dione](/moreStructures/84574-74-3.gif) |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 84574-74-3 |
| SMILES | CC1(C2c3ccccc3C1C(=O)C2=O)C |
| InChI | 1S/C13H12O2/c1-13(2)9-7-5-3-4-6-8(7)10(13)12(15)11(9)14/h3-6,9-10H,1-2H3 |
| InChIKey | YPCHUJWCAZQDMB-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.699°C at 760 mmHg (Cal.) |
| Flash point | 130.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,11-Dimethyltricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dione |