| Beijing Eagle Sky Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Organic fluorine compound |
|---|---|
| Name | 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H4Cl3F3 |
| Molecular Weight | 275.48 |
| CAS Registry Number | 864736-87-8 |
| SMILES | C=C(C1=CC(=C(C(=C1)Cl)Cl)Cl)C(F)(F)F |
| Solubility | Sparingly Soluble (2.4E-4 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.469±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| Index of Refraction | 1.505, Calc.* |
| Boiling Point | 306.7±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 155.4±21.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2021 ACD/Labs) |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338-P302+P352 Details |
| SDS | Available |
|
1,2,3-Trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene is a synthetic organic compound that belongs to the class of chlorinated aromatic compounds. This chemical has gained interest due to its unique molecular structure, which combines the reactivity of chlorinated benzene with the stability and electronic properties conferred by the trifluoromethyl group. The compound consists of a benzene ring substituted with chlorine atoms at positions 1, 2, and 3, and a trifluoromethylvinyl group at position 5. This configuration imparts significant chemical stability and versatility, making it useful in various fields, including materials science and agrochemical development. The discovery of 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene was part of ongoing research into fluorinated compounds, which are known for their ability to enhance the properties of molecules in diverse applications. The trifluoromethyl group is a highly electronegative substituent that contributes to improved chemical resistance, solubility, and lipophilicity. These features are beneficial in applications where high stability and durability are required, such as in advanced materials and industrial chemicals. In terms of applications, 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene is primarily used as an intermediate in the synthesis of specialty chemicals. Its chemical structure allows it to be easily incorporated into more complex molecules with targeted functionalities. One notable application is in the design of agrochemicals, where the compound serves as a precursor for the development of pesticides and herbicides. The trifluoromethylvinyl group improves the compound’s effectiveness by enhancing its bioactivity and resistance to environmental degradation, which is crucial for the long-term effectiveness of agrochemical formulations. Furthermore, 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene plays a role in the synthesis of high-performance polymers. The introduction of trifluoromethyl groups into polymeric materials imparts significant improvements in chemical resistance, thermal stability, and mechanical strength. These enhanced properties are highly desirable in the electronics, coatings, and packaging industries, where polymers must withstand extreme conditions and offer excellent performance. In the field of materials science, the compound is also utilized to create advanced fluorinated materials. These materials exhibit unique properties, such as low surface energy, high chemical resistance, and electrical insulating capabilities. These properties make them particularly useful in the electronics and semiconductor industries, where they are employed in the production of insulating layers, coatings, and electronic components that require superior durability and performance. In conclusion, 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene is a versatile and valuable chemical compound with a wide range of applications in materials science, agrochemicals, and industrial processes. Its unique combination of chlorinated and trifluoromethylated functionalities allows it to serve as a building block for advanced materials and specialty chemicals, particularly in industries that require enhanced stability, resistance, and performance. References none |
| Market Analysis Reports |